|
|
| | 1,4-dibromonaphthalene Basic information |
| Product Name: | 1,4-dibromonaphthalene | | Synonyms: | 1,4-DIBROMONAPHTHALENE;1,4-DIBROMONAPTHALENE;1,4-dibromo-naphthalen;1,4-Dibromonaphthalene,99%;1,4-DIBROMONAPHTHALE;1,4-Dibromonaphthalene, 98+%;1,4-dibroMinated Naphthalenes;1,4-DBN | | CAS: | 83-53-4 | | MF: | C10H6Br2 | | MW: | 285.96 | | EINECS: | 201-484-8 | | Product Categories: | Dibromonaphthalene;Electronic Chemicals | | Mol File: | 83-53-4.mol |  |
| | 1,4-dibromonaphthalene Chemical Properties |
| Melting point | 80-82 °C | | Boiling point | 288.1°C (rough estimate) | | density | 1.8199 (estimate) | | vapor pressure | 0-93.326Pa at 25℃ | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder or Crystals | | color | White to light beige | | Water Solubility | 347.9ug/L(25 ºC) | | Henry's Law Constant | 5.8×10-2 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C10H6Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H | | InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C=CC=C2)=C(Br)C=C1 | | LogP | 4.95-5.02 | | CAS DataBase Reference | 83-53-4(CAS DataBase Reference) | | EPA Substance Registry System | Naphthalene, 1,4-dibromo- (83-53-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-26 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29039990 |
| | 1,4-dibromonaphthalene Usage And Synthesis |
| Chemical Properties | light orange-beige fine crystalline powder | | Uses | 1,4-Dibromonaphthalene is used in the annelation of PAHs. Also used in the synthesis of novel, orally active dual NK1/NK2 antagonists. | | Application | 1,4-Dibromonaphthalene is mainly used for pharmaceutical intermediates. synthesis of tribromo methoxynaphthalenes from 1,4-dibromonaphthalene. starting material 1,4-dibromonaphthalene was prepared starting from naphthalene or 1-bromonaphthalene.
 5,8-Dibromo-1,4-naphthoquinone and 5,8-diiodo-1,4-naphthoquinone were prepared from 1,4-dibromonaphthalene and 1,4-diiodonaphthalene. | | Preparation | An environment-friendly method was developed to synthesize 1,4-dibromonaphthalene (1,4-DBN) using 1,3-dialkylimidazolium and pyridinium ionic liquids as catalysts, over which the yields of 1,4-DBN were obtained as high as 100%. An environment-friendly method for synthesis of 1,4-dibromo-naphthalene in aqueous solution of ionic liquids |
| | 1,4-dibromonaphthalene Preparation Products And Raw materials |
|