| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:L-Threonine-¹³C₄,¹⁵N
CAS:202468-39-1
Purity:≥98 atom% 13C,≥98 atom% 15N Package:5mg/RMB 1123.90;25mg/RMB 3868.90;100mg/RMB 11999.90
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:L-Threonine-13C,1N
CAS:202468-39-1
Purity:98 atom% 13C, 98 atom% 1?N Package:100mg Remarks:S55619
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:L-Threonine-13C4,15N 98 atom % 13C, 98 atom % 15N
CAS:202468-39-1
Purity:95% (CP) Package:100mg;250mg Remarks:NULL
|
| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:L-THREONINE (13C4, 97-99%; 15N, 97-99%)
CAS:202468-39-1
Purity:98% Package:0.5G;0.1G Remarks:CNLM-587-0.1
|
|
| | L-THREONINE (U-13C4) Basic information |
| Product Name: | L-THREONINE (U-13C4) | | Synonyms: | L-THREONINE (U-13C4);L-THREONINE-13C4,15N 98+%13C/98+%15N;L-Threonine-13C?,1?N;L-Threonine-13C4,15N;(2R，3S)-2-(15N)azanyl-3-hydroxy(1，2，3，4-13C4)butanoic acid;L-Threonine (13C?, 97-99% | | CAS: | 202468-39-1 | | MF: | C4H9NO3 | | MW: | 123.16 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | L-THREONINE (U-13C4) Chemical Properties |
| Melting point | 256 °C (dec.) (lit.) | | solubility | Methanol (Very Slightly), Water (Slightly, Sonicated) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D -27.4°, c =1 in H2O | | InChI | 1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i1+1,2+1,3+1,4+1,5+1 | | InChIKey | AYFVYJQAPQTCCC-KJQIOZMZSA-N | | SMILES | [H][13C@]([13CH3])(O)[13C@]([H])([15NH2])[13C](O)=O | | CAS Number Unlabeled | 72-19-5 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | L-THREONINE (U-13C4) Usage And Synthesis |
| Uses | L-Threonine-13C4,15N is an isotopically labelled analog of L-Threonine (T405504), an essential amino acid for human development; last of the common amino acids to be discovered. Identified in oat protein. |
| | L-THREONINE (U-13C4) Preparation Products And Raw materials |
|