- 2-Oxovaleric acid
-
- $73.00 / 10mg
-
2026-01-12
- CAS:1821-02-9
- Min. Order:
- Purity:
- Supply Ability: 10g
- 2-Oxovaleric acid
-
- $73.00 / 10mg
-
2026-01-12
- CAS:1821-02-9
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 2-Oxopentanoic acid Basic information |
| Product Name: | 2-Oxopentanoic acid | | Synonyms: | A-ketovaleric acid free acid;Ketovalericacid;Pentanoic acid, 2-oxo-;2-oxo-n-valeric acid;α-Ketovaleric acid, 2-Oxopentanoic acid;ALPHA-KETO-N-VALERIC ACID;ALPHA-KETOVALERIC ACID;2-OXOPENTANOIC ACID | | CAS: | 1821-02-9 | | MF: | C5H8O3 | | MW: | 116.12 | | EINECS: | 217-340-2 | | Product Categories: | | | Mol File: | 1821-02-9.mol |  |
| | 2-Oxopentanoic acid Chemical Properties |
| Melting point | 7-9 °C(lit.) | | Boiling point | 88-90 °C12 mm Hg(lit.) | | density | 1.110 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.432 | | Fp | 94°C | | storage temp. | 2-8°C | | solubility | DMSO: ≥ 250 mg/mL (2152.95 mM) | | pka | 2.65±0.54(Predicted) | | form | Liquid | | color | Colorless to light yellow | | BRN | 635884 | | InChI | InChI=1S/C5H8O3/c1-2-3-4(6)5(7)8/h2-3H2,1H3,(H,7,8) | | InChIKey | KDVFRMMRZOCFLS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(=O)CCC | | CAS DataBase Reference | 1821-02-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2918.30.9000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Oxopentanoic acid Usage And Synthesis |
| Description | 2-Oxovaleric acid, also known as 2-oxovalerate or a-ketovalerate, belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. 2-Oxovaleric acid has been detected, but not quantified in, several different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), domestic pigs (Sus scrofa domestica), and herbs and spices. This could make 2-oxovaleric acid a potential biomarker for the consumption of these foods. 2-Oxovaleric acid is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. | | Uses | 2-Oxovaleric Acid can be used as a carbon source for immobilized bacteria in micro-biosensors. | | Definition | ChEBI: 2-oxopentanoic acid is an oxopentanoic acid carrying an oxo group at position 2. It has a role as a human metabolite. It is a 2-oxo monocarboxylic acid and an oxopentanoic acid. It is a conjugate acid of a 2-oxopentanoate. | | IC 50 | Human Endogenous Metabolite |
| | 2-Oxopentanoic acid Preparation Products And Raw materials |
|