| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(Bromomethyl-d2)benzene-d5
CAS:35656-93-0
Purity:98%,D 98% Package:1g
|
BENZYL-D7 BROMIDE manufacturers
- BENZYL-D7 BROMIDE
-
- $0.10 / 1KG
-
2025-12-24
- CAS:35656-93-0
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
- Benzyl bromide-d7
-
- $1.00 / 1KG
-
2020-02-26
- CAS: 35656-93-0
- Min. Order: 1KG
- Purity: 99%+
- Supply Ability: 100 tons
- Benzyl bromide-d7
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 35656-93-0
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | BENZYL-D7 BROMIDE Basic information |
| Product Name: | BENZYL-D7 BROMIDE | | Synonyms: | BENZYL-D7 BROMIDE;BENZYL-D7 BROMIDE, 98 ATOM % D;Benzene-d5, (bromomethyl-d2)-;benzyl bromide-d7;α-bromotoluene-d7;1-[bromo(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene;6-(Bromomethyl-d2)benzene-1,2,3,4,5-d5;(Bromomethyl-d2)benzene-d5 | | CAS: | 35656-93-0 | | MF: | C7BrD7 | | MW: | 178.08 | | EINECS: | | | Product Categories: | | | Mol File: | 35656-93-0.mol |  |
| | BENZYL-D7 BROMIDE Chemical Properties |
| Melting point | −3-−1 °C(lit.) | | Boiling point | 198-199 °C(lit.) | | density | 1.497 g/mL at 25 °C | | refractive index | n20/D 1.574(lit.) | | Fp | 188 °F | | InChI | InChI=1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 | | InChIKey | AGEZXYOZHKGVCM-XZJKGWKKSA-N | | SMILES | C1(C([2H])([2H])Br)C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1737 8(6.1) / PGII | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | BENZYL-D7 BROMIDE Usage And Synthesis |
| Uses | Benzyl-d7 Bromide is the isotope labelled analog of Benzyl Bromide (B233650) |
| | BENZYL-D7 BROMIDE Preparation Products And Raw materials |
|