- Benazolin-ethyl
-
- $1.00 / 1KG
-
2019-09-02
- CAS:25059-80-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200kg
|
| | Benazolin-ethyl Basic information |
| Product Name: | Benazolin-ethyl | | Synonyms: | 4-chloro-2-oxo-3(2h)-benzothiazoleaceticaciethylester;4-chloro-2-oxo-3-benzothiazolineaceticaciethylester;ethyl4-chloro-2-oxo-3(2h)-benzothiazoleacetate;7-chloro-2-oxo-3(2h)-benzothiazoleacetic acid ethyl ester;BENAZOLIN-ETHYL;BENAZOLIN-ETHYL ESTER;ethyl 4-chloro-2-oxo-3h-1,3-benzothiazole-3-ylacetate;ETHYL-4-CHLOR-2-OXO-BENZOTHIAZOLINACETAT | | CAS: | 25059-80-7 | | MF: | C11H10ClNO3S | | MW: | 271.72 | | EINECS: | 246-591-0 | | Product Categories: | HERBICIDE | | Mol File: | 25059-80-7.mol |  |
| | Benazolin-ethyl Chemical Properties |
| Melting point | 79°C | | Boiling point | 408.1±55.0 °C(Predicted) | | density | 1.418±0.06 g/cm3(Predicted) | | pka | -2.57±0.20(Predicted) | | BRN | 753659 | | Major Application | agriculture
environmental | | InChI | 1S/C11H10ClNO3S/c1-2-16-9(14)6-13-10-7(12)4-3-5-8(10)17-11(13)15/h3-5H,2,6H2,1H3 | | InChIKey | WQRCEBAZAUAUQC-UHFFFAOYSA-N | | SMILES | CCOC(=O)CN1C(=O)Sc2cccc(Cl)c12 | | CAS DataBase Reference | 25059-80-7(CAS DataBase Reference) | | EPA Substance Registry System | Benazolin-ethyl (25059-80-7) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | RTECS | DL0880000 | | HS Code | 29342000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 |
| | Benazolin-ethyl Usage And Synthesis |
| Uses | Agricultural chemical. | | Definition | ChEBI: The ethyl ester of benazolin. It is used as a post-emergence herbicide used (generally as a salt or ester) for the control of annual weeds in wheat and oilseed rape. It is not approved for use with the European Union. | | Hazard | Moderately toxic by ingestion and skin contact. |
| | Benazolin-ethyl Preparation Products And Raw materials |
|