- 3-Chlorosalicylic acid
-
- $0.00 / 25kg
-
2025-12-01
- CAS:1829-32-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 3-Chlorosalicylic acid Basic information |
| | 3-Chlorosalicylic acid Chemical Properties |
| Melting point | 184-186 °C(lit.) | | Boiling point | 291.7±25.0 °C(Predicted) | | density | 0.863 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Sparingly), Methanol (Slightly) | | pka | 2.43±0.10(Predicted) | | form | Crystalline Powder | | color | White | | InChI | InChI=1S/C7H5ClO3/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,9H,(H,10,11) | | InChIKey | PPINMMULCRBDOS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(Cl)=C1O | | CAS DataBase Reference | 1829-32-9(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Chlorosalicylic acid(1829-32-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2918290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Chlorosalicylic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 3-Chlorosalicylic Acid (cas# 1829-32-9) is a compound useful in organic synthesis. | | General Description | The photocatalytic degradation of 3-chlorosalicylic acid (3-CSA) by pure and Nb-doped TiO2 ceramic membranes was studied. |
| | 3-Chlorosalicylic acid Preparation Products And Raw materials |
|