- 4-Bromodiphenylamine
-
- $68.00 / 25g
-
2026-01-16
- CAS:54446-36-5
- Min. Order: 25g
- Purity: 0.98
- Supply Ability: 25kg
- 4-Bromodiphenylamine
-
- $1.00 / 1KG
-
2026-01-05
- CAS:54446-36-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 4-Bromodiphenylamine
-
- $0.00 / 25kg
-
2025-12-24
- CAS:54446-36-5
- Min. Order: 25kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 4-Bromodiphenylamine Basic information | | Uses |
| Product Name: | 4-Bromodiphenylamine | | Synonyms: | (4-BROMO-PHENYL)-PHENYL-AMINE;4-BROMODIPHENYLAMINE;1-(4-BROMOPHENYL)ANILINE;N-PHENYL-4-BROMOANILINE;1-(4-Bromophenyl)aniline, N-phenyl-4-bromoaniline;4-Bromo-N-phenylbenzenamine;4-Bromo-N-phenylaniline;N-(4-Bromophenyl)benzenamine | | CAS: | 54446-36-5 | | MF: | C12H10BrN | | MW: | 248.12 | | EINECS: | 626-191-6 | | Product Categories: | Aryl;Organohalides | | Mol File: | 54446-36-5.mol |  |
| | 4-Bromodiphenylamine Chemical Properties |
| Melting point | 85-89 °C | | Boiling point | 318°C(lit.) | | density | 1.445±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Toluene | | form | powder to crystal | | pka | 0.11±0.20(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C12H10BrN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H | | InChIKey | CCIVUDMVXNBUCY-UHFFFAOYSA-N | | SMILES | C1(NC2=CC=CC=C2)=CC=C(Br)C=C1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-37/38-41-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HazardClass | 9 | | PackingGroup | Ⅲ | | HS Code | 29214990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 4-Bromodiphenylamine Usage And Synthesis |
| Uses | 4-Bromophenylaniline is an aniline organic compound that can be used as an organic reagent. | | Chemical Properties | White solid |
| | 4-Bromodiphenylamine Preparation Products And Raw materials |
|