|
|
| | 2,3,4,5,6-PENTABROMOBENZYL ALCOHOL Basic information |
| Product Name: | 2,3,4,5,6-PENTABROMOBENZYL ALCOHOL | | Synonyms: | PENTABROMOBENZYL ALCOHOL;2,3,4,5,6-PENTABROMOBENZYL ALCOHOL 97%;2,3,4,5,6-Pentabromobenzyl alcohol,97%;2,3,4,5,6-PENTABROMOBENZYL ALCOHOL;(PENTABROMOPHENYL)METHANOL;PentabromobenzylAlcohol>;Benzenemethanol, 2,3,4,5,6-pentabromo- | | CAS: | 79415-41-1 | | MF: | C7H3Br5O | | MW: | 502.62 | | EINECS: | | | Product Categories: | Alcohols;C7 to C8;Oxygen Compounds | | Mol File: | 79415-41-1.mol |  |
| | 2,3,4,5,6-PENTABROMOBENZYL ALCOHOL Chemical Properties |
| Melting point | 260 °C (dec.)(lit.) | | density | 2.6939 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Storage temp. 2-8°C | | form | Crystalline Powder | | color | White to light yellow | | InChI | 1S/C7H3Br5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2 | | InChIKey | KKWHDMUCBWSKGL-UHFFFAOYSA-N | | SMILES | OCc1c(Br)c(Br)c(Br)c(Br)c1Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29062900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,3,4,5,6-PENTABROMOBENZYL ALCOHOL Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder | | Uses | 2,3,4,5,6-Pentabromobenzyl Alcohol is used in the synthesis of precursor flame suppressing polymers. | | General Description | 2,3,4,5,6-Pentabromobenzyl alcohol is an organic building block. It is formed during the hydrolysis of polymeric brominated flame retardant FR-1025. |
| | 2,3,4,5,6-PENTABROMOBENZYL ALCOHOL Preparation Products And Raw materials |
|