p-Naphtholbenzein manufacturers
- p-Naphtholbenzein
-
- $5.00 / 1kg
-
2025-09-25
- CAS:145-50-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- α-Naphtholbenzein
-
- $9.80 / 1KG
-
2020-02-11
- CAS:145-50-6
- Min. Order: 1g
- Purity: ＞98%
- Supply Ability: 20 tons
|
| | p-Naphtholbenzein Basic information |
| Product Name: | p-Naphtholbenzein | | Synonyms: | α-Naphtholbenzein,4,4′-(α-Hydroxybenzylidene)di-1-naphthol, p-naphtholbenzein;alpha-Naphtholbenzein, pure, 90% 10GR;alpha-Naphtholbenzein, pure, 90% 25GR;1-NAPHTHOLBENZEIN INDICATOR 5 G;α- naphthol quinone phenylMethane;MAG BIND EQUIPURE GDNA (1X96);1-Naphtholbenzein indicator Reag. Ph Eur;1(4H)-Naphthalenone, 4-(4-hydroxy-1-naphthalenyl)phenylmethylene- | | CAS: | 145-50-6 | | MF: | C27H18O2 | | MW: | 374.43 | | EINECS: | 205-656-3 | | Product Categories: | Benzein;Analytical Chemistry;Indicator (pH);pH Indicators | | Mol File: | 145-50-6.mol |  |
| | p-Naphtholbenzein Chemical Properties |
| Melting point | 230-235 °C(lit.) | | Boiling point | 463.44°C (rough estimate) | | bulk density | 120-300kg/m3 | | density | 1.0946 (rough estimate) | | vapor density | 12.9 (vs air) | | refractive index | 1.4875 (estimate) | | storage temp. | Store at +5°C to +30°C. | | solubility | Solubility Insoluble in water; soluble in ethanol, methanol | | pka | 8.95(at 25℃) | | form | Liquid | | color | Pale Red-Brown | | Odor | Odorless | | PH | 0.0, green
0.8, yellow
10.0, blue-green
8.2, yellow | | PH Range | Green (0.0) to yellow (0.8);Yellow (8.2) to green-blue (11.0) | | Water Solubility | insoluble | | ε(extinction coefficient) | ≥50000 at 207-213nm in methanol at 0.01g/L | | λmax | 210nm | | BRN | 3471575 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C27H18O2/c28-25-16-14-23(19-10-4-6-12-21(19)25)27(18-8-2-1-3-9-18)24-15-17-26(29)22-13-7-5-11-20(22)24/h1-17,28H/b27-24- | | InChIKey | VDDWRTZCUJCDJM-SOYKGTTHSA-N | | SMILES | Oc1ccc(\C(c2ccccc2)=C3\C=CC(=O)c4ccccc34)c5ccccc15 | | CAS DataBase Reference | 145-50-6(CAS DataBase Reference) | | EPA Substance Registry System | 1(4H)-Naphthalenone, 4-[(4-hydroxy-1-naphthalenyl)phenylmethylene]- (145-50-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 29145000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | p-Naphtholbenzein Usage And Synthesis |
| Chemical Properties | deep red to rust-coloured crystals | | Uses | alpha-Naphtholbenzein is a pH indicator (pH 0.0-0.8/ pH 8.2-10.0). Dyes and metabolites. |
| | p-Naphtholbenzein Preparation Products And Raw materials |
|