| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:3-Nitrobenzenesulfonyl chloride
CAS:121-51-7
Purity:>=97% Package:100g Remarks:W12442
|
|
| | 3-Nitrobenzenesulfonyl chloride Basic information |
| | 3-Nitrobenzenesulfonyl chloride Chemical Properties |
| Melting point | 61-62 °C(lit.) | | Boiling point | approximate 341℃ | | density | 1.602 (estimate) | | refractive index | 1.6000 (estimate) | | Fp | >110°C | | storage temp. | Store below +30°C. | | form | Crystalline Powder | | color | Light beige to yellow | | Water Solubility | Decomposes | | Sensitive | Moisture Sensitive | | BRN | 746542 | | InChI | 1S/C6H4ClNO4S/c7-13(11,12)6-3-1-2-5(4-6)8(9)10/h1-4H | | InChIKey | MWWNNNAOGWPTQY-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(c1)S(Cl)(=O)=O | | CAS DataBase Reference | 121-51-7(CAS DataBase Reference) | | NIST Chemistry Reference | M-nitrobenzene sulfonyl chloride(121-51-7) | | EPA Substance Registry System | Benzenesulfonyl chloride, 3-nitro- (121-51-7) |
| Hazard Codes | C | | Risk Statements | 34-29-14 | | Safety Statements | 26-36/37/39-45-8 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 21 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 3-Nitrobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | light beige to yellow crystalline powder | | Uses | It is employed as a biochemical for proteomics research. It is also used in the preparation of: acyl-2-aminobenzimidazole analogs and 6-chloro-2-methyl-3-{1-[(3-nitrophenyl)sulfonyl]-1H-pyrazol-3-yl}imidazo[1,2-a]pyridine. | | Production Methods | Nitrobenzene is added to excess chlorosulfonic acid, and the temperature is raised gradually to 100 ℃ and held there for 6 h. After cooling, the mixture is poured into ice and water, and 3-nitrobenzenesulfonyl chloride is filtered off in 75 % yield for use as a paste, after being washed (to remove acid) with cold water. |
| | 3-Nitrobenzenesulfonyl chloride Preparation Products And Raw materials |
|