4-N-DECYLBENZOYL CHLORIDE manufacturers
- 4-Decylbenzoyl chloride
-
- $0.00 / 1Kg
-
2020-02-26
- CAS: 54256-43-8
- Min. Order: 1KG
- Purity: 99.0%+
- Supply Ability: 100 tons
|
| | 4-N-DECYLBENZOYL CHLORIDE Basic information |
| Product Name: | 4-N-DECYLBENZOYL CHLORIDE | | Synonyms: | P-DECYLBENZOYL CHLORIDE;4-N-DECYLBENZOYL CHLORIDE;4-DECYLBENZOYL CHLORIDE;4-decyl-benzoylchlorid;4-Decylbenzoic acid chloride;4-Decylbenzoyl chloride,98%;Benzoyl chloride, 4-decyl-;4-N-DECYLBENZOYL CHLORIDE ISO 9001：2015 REACH | | CAS: | 54256-43-8 | | MF: | C17H25ClO | | MW: | 280.83 | | EINECS: | 259-046-7 | | Product Categories: | | | Mol File: | 54256-43-8.mol |  |
| | 4-N-DECYLBENZOYL CHLORIDE Chemical Properties |
| Boiling point | 172 °C (2 mmHg) | | density | 1.0114 (estimate) | | refractive index | 1.512-1.514 | | Fp | 171-173°C/2mm | | form | solid | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C17H25ClO/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19/h11-14H,2-10H2,1H3 | | InChIKey | HEWLDHSFOQXCSI-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCc1ccc(cc1)C(Cl)=O | | EPA Substance Registry System | Benzoyl chloride, 4-decyl- (54256-43-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 24/25 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 4-N-DECYLBENZOYL CHLORIDE Usage And Synthesis |
| Chemical Properties | CLEAR LIGHT YELLOW LIQUID | | Uses | Employed as a pharmaceutical and chemical intermediate. |
| | 4-N-DECYLBENZOYL CHLORIDE Preparation Products And Raw materials |
|