|
|
| | 1,6-HEPTADIEN-4-OL Basic information |
| Product Name: | 1,6-HEPTADIEN-4-OL | | Synonyms: | 1,6-HEPTADIENE-4-OL;1,6-HEPTADIEN-4-OL;1,6-HEPTADIEN-4-OL 97%;1,6-Heptadien-4-ol,97%;1,6-Heptadien-4-ol, 97% 5GR;4-hepta-1,6-dienol;1,6-HEPTADIEN-4-OL ISO 9001:2015 REACH;hepta-1,6-dien-4-ol | | CAS: | 2883-45-6 | | MF: | C7H12O | | MW: | 112.17 | | EINECS: | 220-742-0 | | Product Categories: | Acyclic;Alkenes;Organic Building Blocks | | Mol File: | 2883-45-6.mol |  |
| | 1,6-HEPTADIEN-4-OL Chemical Properties |
| Boiling point | 151 °C (lit.) | | density | 0.864 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.45(lit.) | | Fp | 104 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid | | color | Clear colorless to light yellow | | InChI | InChI=1S/C7H12O/c1-3-5-7(8)6-4-2/h3-4,7-8H,1-2,5-6H2 | | InChIKey | UTGFOWQYZKTZTN-UHFFFAOYSA-N | | SMILES | C=CCC(O)CC=C | | LogP | 1.911 (est) | | CAS DataBase Reference | 2883-45-6(CAS DataBase Reference) |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1987 3/PG 3 | | WGK Germany | 3 | | RTECS | MI5450000 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29052990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 1,6-HEPTADIEN-4-OL Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid | | Uses | 1,6-Heptadien-4-ol (monoterpene alcohol) was used as the internal standard in the quantitation and identification of the important aroma components in wine. It was used to study the co- and terpolymerization reactions of carbon monoxide and propene with dicationic biphosphine palladium(II) as the catalyst. | | General Description | 1,6-Heptadien-4-ol can help in synthesizing the derivatives of guanine, adenine, uracil and thymine via Mitsunobu condensation. |
| | 1,6-HEPTADIEN-4-OL Preparation Products And Raw materials |
|