1-CHLORO-3-METHOXY-2-PROPANOL manufacturers
|
| | 1-CHLORO-3-METHOXY-2-PROPANOL Basic information |
| Product Name: | 1-CHLORO-3-METHOXY-2-PROPANOL | | Synonyms: | 1-CHLORO-3-METHOXY-2-PROPANOL;3-CHLORO-1-METHOXY-2-PROPANOL;3-CHLORO-2-HYDROXYPROPYL METHYL ETHER;1-Methoxy-3-chloro-2-propanol;3-CHLORO-1-METHOXY-2-PROPANOL FOR SYNTHE;3-Chloro-1-methoxy-2-propanol for synthesis;2-Propanol, 1-chloro-3-methoxy-;1-CHLORO-3-METHOXY-2-PROPANOL 98+% | | CAS: | 4151-97-7 | | MF: | C4H9ClO2 | | MW: | 124.57 | | EINECS: | 223-982-4 | | Product Categories: | | | Mol File: | 4151-97-7.mol |  |
| | 1-CHLORO-3-METHOXY-2-PROPANOL Chemical Properties |
| Boiling point | 171°C | | density | 1,161 g/cm3 | | refractive index | 1.4463 | | Fp | 72°C | | storage temp. | Store below +30°C. | | solubility | Chloroform, DMSO (Sparingly), Methanol (Slightly) | | pka | 13.28±0.20(Predicted) | | form | Oily Liquid | | color | Clear faintly yellow | | PH | 5.6 (50g/l, H2O) | | BRN | 1697491 | | InChI | InChI=1S/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 | | InChIKey | FOLYKNXDLNPWGC-UHFFFAOYSA-N | | SMILES | C(Cl)C(O)COC |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36-36/37/38 | | Safety Statements | 23-26-36/37/39-36 | | RIDADR | 2810 | | WGK Germany | WGK 3 highly water endangering | | HS Code | 2909 49 80 | | PackingGroup | III | | Toxicity | LD50 orally in Rabbit: 340 mg/kg |
| Provider | Language |
|
ALFA
| English |
| | 1-CHLORO-3-METHOXY-2-PROPANOL Usage And Synthesis |
| Chemical Properties | Clear faintly yellow oily liquid | | Uses | 1-Chloro-3-methoxy-2-propanol is used in the synthesis of O-Methylganciclovir (M275440), an analogue of Ganciclovir (G235000) and displays excellent antiviral activity when tested in vivo against herpes simplex virus type 1 infection in mice. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 53, p. 275, 1988 DOI: 10.1021/jo00237a009 Synthetic Communications, 24, p. 1959, 1994 DOI: 10.1080/00397919408010203 |
| | 1-CHLORO-3-METHOXY-2-PROPANOL Preparation Products And Raw materials |
|