|
|
| | TETRAPROPYLAMMONIUM PERRUTHENATE Basic information | | Uses |
| Product Name: | TETRAPROPYLAMMONIUM PERRUTHENATE | | Synonyms: | TETRAPROPYLAMMONIUM PERRUTHENATE;TETRA-N-PROPYLAMMONIUM PERRUTHENATE;TETRA-N-PROPYLAMMONIUM PERRUTHENATE (VII);TPAP;Tetrapropylammonium tetraoxoruthenate;TerapropylaMMoniuMperruthenate;TetrapropylaMMoniuM perruthenate,97% TPAP, (n-C3H7)4NRuO4;1-Propanaminium, N,N,N-tripropyl-, (T-4)-tetraoxoru | | CAS: | 114615-82-6 | | MF: | C12H28NO4Ru | | MW: | 351.43 | | EINECS: | 628-415-8 | | Product Categories: | Boron, Nitrile, Thio,& TM-Cpds;Ammonium Polyhalides, etc. (Quaternary);Catalysts for Organic Synthesis;Classes of Metal Compounds;Environmentally-friendly Oxidation;Homogeneous Catalysts;Metal Complexes;Oxidation;Quaternary Ammonium Compounds;Ru (Ruthenium) Compounds;Synthetic Organic Chemistry;Transition Metal Complexes (Environmentally-friendly Oxidation);Transition Metal Compounds;Ru;Alkylammonium salt | | Mol File: | 114615-82-6.mol |  |
| | TETRAPROPYLAMMONIUM PERRUTHENATE Chemical Properties |
| Melting point | ~160 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Methanol (Slightly) | | form | crystal | | color | green | | Water Solubility | Insoluble in water. | | Sensitive | Hygroscopic | | Stability: | store cold | | InChI | InChI=1S/C12H28N.4O.Ru/c1-5-9-13(10-6-2,11-7-3)12-8-4;;;;;/h5-12H2,1-4H3;;;;;/q+1;;;;;-1 | | InChIKey | NQSIKKSFBQCBSI-UHFFFAOYSA-N | | SMILES | [N+](CCC)(CCC)(CCC)CCC.[Ru-](=O)(=O)(=O)=O |
| Hazard Codes | O,Xi | | Risk Statements | 5-8-36/37/38 | | Safety Statements | 17-26-36 | | RIDADR | UN 1479 5.1/PG 2 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids |
| | TETRAPROPYLAMMONIUM PERRUTHENATE Usage And Synthesis |
| Uses | A mild oxidant for the selective transformation of primary alcohols to aldehydes and secondary alcohols to ketones.
| | Chemical Properties | dark green solid | | Uses | Tetrapropylammonium Perruthenate is used in sustainable oxidation reactions and has potential for chemical recycling. | | Definition | ChEBI: A quaternary ammonium salt having tetrapropylammonium as the cation and perruthenate as the anion. | | General Description | Tetrapropylammonium perruthenate is a mild oxidizing agent used for the oxidation of alcohols to corresponding carbonyl compounds. It is a non-volatile, air-stable, and readily soluble reagent, which can be used either stoichiometrically or catalytically with a suitable co-oxidant. | | reaction suitability | reagent type: oxidant | | Purification Methods | It is a strong oxidant and may explode on heating. It can be washed with aqueous n-propanol, then H2O and dried over KOH in a vacuum. It is stable at room temperature but best stored in a refrigerator. It is soluble in CH2Cl2 and MeCN. [Dengel et al. Transition Met Chem 10 98 1985, Griffith et al. J Chem Soc, Chem Commun 1625 1987.] § Polymer supported reagent is available commercially. |
| | TETRAPROPYLAMMONIUM PERRUTHENATE Preparation Products And Raw materials |
|