|
|
| | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine Basic information |
| | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine Chemical Properties |
| Melting point | 189-190 °C | | Boiling point | 515.7±50.0 °C(Predicted) | | density | 1.239±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.17±0.40(Predicted) | | color | Yellow to Dark Brown | | Water Solubility | 36.9μg/L at 20℃ | | InChI | InChI=1S/C17H19N3O3/c1-23-17-8-6-15(7-9-17)19-12-10-18(11-13-19)14-2-4-16(5-3-14)20(21)22/h2-9H,10-13H2,1H3 | | InChIKey | AVCKOFMRPAJEPN-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(OC)C=C2)CCN(C2=CC=C([N+]([O-])=O)C=C2)CC1 | | LogP | 3.4 at 20℃ | | CAS DataBase Reference | 74852-61-2(CAS DataBase Reference) |
| | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Intermediate in the preparation of angiogenesis inhibitors | | Flammability and Explosibility | Not classified |
| | 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine Preparation Products And Raw materials |
|