|
|
| | Ruthenium nitrosyl nitrate Basic information |
| | Ruthenium nitrosyl nitrate Chemical Properties |
| density | 1.07 | | form | Solution | | Specific Gravity | 1.65 | | color | Red-brown | | Water Solubility | Miscible with cold water. | | Exposure limits | ACGIH: TWA 2 ppm; STEL 4 ppm
OSHA: TWA 2 ppm(5 mg/m3)
NIOSH: IDLH 25 ppm; TWA 2 ppm(5 mg/m3); STEL 4 ppm(10 mg/m3) | | InChI | InChI=1S/3NO3.NO.Ru/c3*2-1(3)4;1-2;/q3*-1;+1;+2 | | InChIKey | VAAILMLOAHTPQK-UHFFFAOYSA-N | | SMILES | [Ru+2](N#[O+])([O-]N(=O)=O)([O-]N(=O)=O)[O-]N(=O)=O | | CAS DataBase Reference | 34513-98-9(CAS DataBase Reference) | | EPA Substance Registry System | Ruthenium, tris(nitrato-.kappa.O)nitrosyl- (34513-98-9) |
| Hazard Codes | C,O | | Risk Statements | 35-34 | | Safety Statements | 45-36-26-23-36/37/39 | | RIDADR | 3264 | | WGK Germany | 2 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | II | | HS Code | 28439000 |
| | Ruthenium nitrosyl nitrate Usage And Synthesis |
| Chemical Properties | deep red brown solution | | Uses | Trinitratonitroso-ruthenium is a coordination complex which is used as catalyst for research purposes. | | Flammability and Explosibility | Not classified | | reaction suitability | reagent type: catalyst
core: ruthenium |
| | Ruthenium nitrosyl nitrate Preparation Products And Raw materials |
|