|
|
| | 4'-TERT-BUTYL-2',6'-DIMETHYLACETOPHENONE Basic information |
| | 4'-TERT-BUTYL-2',6'-DIMETHYLACETOPHENONE Chemical Properties |
| Melting point | 47-49 °C(lit.) | | Boiling point | 150 °C20 mm Hg(lit.) | | density | 0.9463 (rough estimate) | | refractive index | 1.5397 (estimate) | | form | solid | | Odor | at 10.00 % in dipropylene glycol. strong dry woody labdanum rose musk orangeflower | | Odor Type | woody | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C14H20O/c1-9-7-12(14(4,5)6)8-10(2)13(9)11(3)15/h7-8H,1-6H3 | | InChIKey | JNHLHPMTMTYLCP-UHFFFAOYSA-N | | SMILES | CC(=O)c1c(C)cc(cc1C)C(C)(C)C | | LogP | 2.913 (est) | | EPA Substance Registry System | Ethanone, 1-[4-(1,1-dimethylethyl)-2,6-dimethylphenyl]- (2040-10-0) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | 4'-TERT-BUTYL-2',6'-DIMETHYLACETOPHENONE Usage And Synthesis |
| | 4'-TERT-BUTYL-2',6'-DIMETHYLACETOPHENONE Preparation Products And Raw materials |
|