|
|
| | Diethyl oxalacetate sodium salt Basic information |
| Product Name: | Diethyl oxalacetate sodium salt | | Synonyms: | ETHYL SODIUM OXALACETATE;ETHYL SODIUM OXALOACETATE;OXALACETIC ACID DIETHYL ESTER SODIUM*PRA CTICAL GRAD;DiethyloxalacetateSodiumSalt98%;Diethyl oxalacetate sodium salt, pract., 95%;diethyl oxaloacetate, monosodium salt;DIEHTYLOXALACETATESODIUMSALT;Diethyl oxalacetate, Diethyl oxaloacetate, Diethyl oxosuccinate sodium salt, Oxalacetic acid diethyl ester sodium salt, Sodium diethyl oxalacetate | | CAS: | 40876-98-0 | | MF: | C8H11NaO5 | | MW: | 210.16 | | EINECS: | 255-122-9 | | Product Categories: | API intermediates;Pharmaceutical Intermediates | | Mol File: | 40876-98-0.mol |  |
| | Diethyl oxalacetate sodium salt Chemical Properties |
| Melting point | 188-190 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline Powder | | color | Beige to light orange | | Water Solubility | Slightly soluble in water (1.2 g/L) (25°C). | | Sensitive | Moisture Sensitive | | BRN | 4279609 | | InChI | InChI=1S/C8H11O5.Na/c1-3-12-7(10)5-6(9)8(11)13-4-2;/h5H,3-4H2,1-2H3;/q-1;+1 | | InChIKey | JPTKZRPOIUYFTM-UHFFFAOYSA-N | | SMILES | [CH-](C(=O)OCC)C(=O)C(=O)OCC.[Na+] | | CAS DataBase Reference | 40876-98-0(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, oxo-, diethyl ester, ion(1-), sodium (40876-98-0) |
| Hazard Codes | T,Xi | | Risk Statements | 45-46-48/20/21/22-36-36/38 | | Safety Statements | 26-24/25-45-53 | | WGK Germany | 3 | | RTECS | EK0115500 | | TSCA | TSCA listed | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 | | Toxicity | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 9, 1953. |
| | Diethyl oxalacetate sodium salt Usage And Synthesis |
| Chemical Properties | beige to light orange crystalline powder | | Uses | Dyes, synthesis. | | Uses | Diethyl oxalacetate sodium salt is used in the preparation of oxaloacetic acid. It is also used as an active pharmaceutical intermediate. | | Purification Methods | Extract it several times with boiling Et2O (until the solvent remains colourless), and then the residue is dried in air. [Beilstein 3 H 789.] |
| | Diethyl oxalacetate sodium salt Preparation Products And Raw materials |
|