| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
CP-944629 manufacturers
- CP-944629
-
- $1520.00
-
2026-05-21
- CAS:668990-94-1
- Purity:
- Supply Ability: 10g
|
| | CP-944629 Basic information |
| Product Name: | CP-944629 | | Synonyms: | CP-944629;1,2,4-Triazolo[4,3-a]pyridine, 3-(1,1-dimethylethyl)-6-[4-(2,4,5-trifluorophenyl)-5-oxazolyl]-;CP-944629 >=98% (HPLC) | | CAS: | 668990-94-1 | | MF: | C19H15F3N4O | | MW: | 372.34 | | EINECS: | | | Product Categories: | | | Mol File: | 668990-94-1.mol |  |
| | CP-944629 Chemical Properties |
| density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: 10mg/mL, clear | | form | powder | | pka | 2.70±0.50(Predicted) | | color | white to beige | | InChI | 1S/C19H15F3N4O/c1-19(2,3)18-25-24-15-5-4-10(8-26(15)18)17-16(23-9-27-17)11-6-13(21)14(22)7-12(11)20/h4-9H,1-3H3 | | InChIKey | VNZJNPIWZYMGAO-UHFFFAOYSA-N | | SMILES | CC(C)(C)C1=NN=C2C=CC(C3=C(C4=C(F)C=C(F)C(F)=C4)N=CO3)=CN21 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CP-944629 Usage And Synthesis |
| Biochem/physiol Actions | CP-9446219 is a potent p38alpha (p38α) inhibitor (IC50 = 1.8 nM) with no inhibitory potency against a panel of 26 other knases (IC50 >10 μM), including p38gamma (p38γ) and p38delta (p38δ), MKK1, MAPK2/ERK2, JNK, MAPKAP-K1a, and MAPKAP-K2. CP-944629 effectively inhibits LPS-stimulated cellular TNF-α production in vitro (IC50 = 63 and 8.3 nM, using human whole blood and isolated mononuclear cells, respectively) and in rats in vivo (ED50 = 0.1 mg/kg p.o.) with good pharmacokinetic profile and oral availability (F = 66%/monkey, 54%/rat). |
| | CP-944629 Preparation Products And Raw materials |
|