| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Wasa-Yu MPAA Ligand CAS:1346641-35-7 Purity:Wasa-Yu MPAA Ligand Package:100MG Remarks:ALD00378-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Wasa-Yu MPAA Ligand CAS:1346641-35-7 Purity:NULL Package:100mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Wasa-Yu MPAA Ligand CAS:1346641-35-7
|
| Company Name: |
Sigma-Aldrich Japan K.K.
|
| Tel: |
81-3-6756-8200 |
| Email: |
sialjp@sial.com |
| Products Intro: |
Product Name:WASA-YU MPAA LIGAND CAS:1346641-35-7
|
|
| | WASA-YU MPAA LIGAND Basic information |
| | WASA-YU MPAA LIGAND Chemical Properties |
| density | 1.365 g/cm3±0.06 g/cm3 | | storage temp. | 2-8°C | | form | solid | | Boiling point | 521.1°C±50.0°C | | InChI | 1S/C18H22Cl3F2NO4/c1-3-8-17(9-4-2,18(19,20)21)28-16(27)24-14(15(25)26)10-11-12(22)6-5-7-13(11)23/h5-7,14H,3-4,8-10H2,1-2H3,(H,24,27)(H,25,26)/t14-/m0/s1 | | InChIKey | MYNBDMWXOQDYED-AWEZNQCLSA-N | | SMILES | O=C(O)[C@@H](NC(OC(CCC)(CCC)C(Cl)(Cl)Cl)=O)CC1=C(F)C=CC=C1F |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | WASA-YU MPAA LIGAND Usage And Synthesis |
| Uses | The Wasa-Yu MPAA Ligand has been reported by Yu and coworkers to promote the enantioselective C-H activation of cyclopropanes. This transformation is carried out through the coupling of organoboron reagents using palladium-mediated catalysis. | | reaction suitability | reaction type: C-H Activation reagent type: catalyst reagent type: ligand reaction type: Peptide Synthesis |
| | WASA-YU MPAA LIGAND Preparation Products And Raw materials |
|