|
|
| | 4-DIMETHYLAMINO-4'-NITROSTILBENE Basic information |
| Product Name: | 4-DIMETHYLAMINO-4'-NITROSTILBENE | | Synonyms: | (E)-4-(Dimethylamino)-4'-nitrostilbene;N,N-Dimethyl-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline;N,N-DIMETHYL-4'-NITRO-4-STILBENAMINE;4-DIMETHYLAMINO-4'-NITROSTILBENE 97%;N,N-Dimethyl-4μ-nitro-4-stilbenamine, DANS;Benzenamine, N,N-dimethyl-4-[(1E)-2-(4-nitrophenyl)ethenyl]-;4-Dimethylamino-4’-nitrostilbene | | CAS: | 2844-15-7 | | MF: | C16H16N2O2 | | MW: | 268.31 | | EINECS: | | | Product Categories: | | | Mol File: | 2844-15-7.mol |  |
| | 4-DIMETHYLAMINO-4'-NITROSTILBENE Chemical Properties |
| Melting point | 256-259 °C(lit.) | | Boiling point | 411.7±24.0 °C(Predicted) | | density | 1.206±0.06 g/cm3(Predicted) | | pka | 4.12±0.15(Predicted) | | form | solid | | BRN | 1379389 | | InChI | 1S/C16H16N2O2/c1-17(2)15-9-5-13(6-10-15)3-4-14-7-11-16(12-8-14)18(19)20/h3-12H,1-2H3/b4-3+ | | InChIKey | NVLSIZITFJRWPY-ONEGZZNKSA-N | | SMILES | CN(C)c1ccc(\C=C\c2ccc(cc2)[N+]([O-])=O)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-DIMETHYLAMINO-4'-NITROSTILBENE Usage And Synthesis |
| Uses | 4-Dimethylamino-4''-nitrostilbene is a useful standard for the correction of emission of fluorescence spectrometers. | | Definition | ChEBI: 4-dimethylamino-4'-nitrostilbene is a substituted aniline. It has a role as a fluorochrome. |
| | 4-DIMETHYLAMINO-4'-NITROSTILBENE Preparation Products And Raw materials |
|