2-(difluoromethoxy)ethan-1-amine manufacturers
|
| | 2-(difluoromethoxy)ethan-1-amine Basic information |
| | 2-(difluoromethoxy)ethan-1-amine Chemical Properties |
| Boiling point | 84.7±30.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | pka | 7.94±0.10(Predicted) | | InChI | InChI=1S/C3H7F2NO/c4-3(5)7-2-1-6/h3H,1-2,6H2 | | InChIKey | XVHQHDWOVYAABP-UHFFFAOYSA-N | | SMILES | C(N)COC(F)F |
| | 2-(difluoromethoxy)ethan-1-amine Usage And Synthesis |
| Uses | 2-(Difluoromethoxy)ethan-1-amine is used as a reagent in the preparation of amino acid compounds as alpha-v-beta-6 integrin inhibitors for treating respiratory diseases including COVID-19 associated acute respiratory distress syndrome. |
| | 2-(difluoromethoxy)ethan-1-amine Preparation Products And Raw materials |
|