DLinDMA manufacturers
- DLinDMA
-
- $64.00
-
2026-04-27
- CAS:871258-12-7
- Purity: 99.42%
- Supply Ability: 10g
|
| | DLinDMA Basic information |
| Product Name: | DLinDMA | | Synonyms: | DLinDMA;1,2-Dilinoleyloxy-N,N-dimethyl-3-aminopropane;1-Propanamine, N,N-dimethyl-2,3-bis[(9Z,12Z)-9,12-octadecadien-1-yloxy]-;Inhibitor,DLinDMA,inhibit;N,N-Dimethyl-2,3-bis(((9Z,12Z)-octadeca-9,12-dien-1-yl)oxy)propan-1-amine | | CAS: | 871258-12-7 | | MF: | C41H77NO2 | | MW: | 616.06 | | EINECS: | | | Product Categories: | | | Mol File: | 871258-12-7.mol |  |
| | DLinDMA Chemical Properties |
| Boiling point | 647.8±55.0 °C(Predicted) | | density | 0.879±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:100.0(Max Conc. mg/mL);162.32(Max Conc. mM)
Ethanol:3.0(Max Conc. mg/mL);4.87(Max Conc. mM) | | form | Liquid | | pka | 8.65±0.28(Predicted) | | color | Colorless to light yellow | | InChIKey | NFQBIAXADRDUGK-KWXKLSQISA-N | | SMILES | C(N(C)C)C(OCCCCCCCC/C=C\C/C=C\CCCCC)COCCCCCCCC/C=C\C/C=C\CCCCC |
| | DLinDMA Usage And Synthesis |
| Uses | DLinDMA, a ionizable cationic lipid, is a key lipid component of stable nucleic acid lipid particles (SNALPs) as a benchmark. DLinDMA is used for siRNA delivery[1]. | | in vivo | DLinDMA has virtually indistinguishable blood pharmacokinetic profiles in mice[1]. | | References | [1] Semple SC, et al. Rational design of cationic lipids for siRNA delivery. Nat Biotechnol. 2010 Feb;28(2):172-6. DOI:10.1038/nbt.1602 |
| | DLinDMA Preparation Products And Raw materials |
|