- 5-Hydroxyanthranilic acid
-
- $3.90 / 100KG
-
2025-10-13
- CAS:394-31-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 5-Hydroxyanthranilic acid Basic information |
| | 5-Hydroxyanthranilic acid Chemical Properties |
| Melting point | 247 °C (dec.) (lit.) | | Boiling point | 276.03°C (rough estimate) | | density | 1.3585 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 2.08±0.10(Predicted) | | form | Crystalline Powder | | color | Gray-brownish | | Water Solubility | Insoluble | | BRN | 2803663 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H7NO3/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3,9H,8H2,(H,10,11) | | InChIKey | HYNQTSZBTIOFKH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(O)=CC=C1N | | CAS DataBase Reference | 394-31-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-20/22 | | Safety Statements | 26-36-36/37/39 | | WGK Germany | 3 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Hydroxyanthranilic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | An oral anti-diabetic drug. | | Application | 5-Hydroxyanthranilic acid can be used as an intermediate of azo and sulfur dyes for the manufacture of photosensitive paper. | | Definition | ChEBI: 2-Amino-5-hydroxybenzoic acid is a hydroxybenzoic acid. | | reaction suitability | reaction type: solution phase peptide synthesis | | Purification Methods | Crystallise the acid from water. The benzamide has m 240-242o (fromAcOH). It is a hypoglycemic agent.[Beilstein 14 H 591, 14 II 357, 14 III 1468, 14 IV 2080.] |
| | 5-Hydroxyanthranilic acid Preparation Products And Raw materials |
|