|
|
| | 3-CHLORO-2-HYDROXY-BENZALDEHYDE Basic information |
| | 3-CHLORO-2-HYDROXY-BENZALDEHYDE Chemical Properties |
| Melting point | 42-44°C | | Boiling point | 63°C/5mmHg(lit.) | | density | 1.404±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Acetone (Slightly), Chloroform (Slightly), Dichloromethane (Slightly), DMSO(Slightly) | | pka | 6.70±0.10(Predicted) | | form | Solid | | color | Pale Beige to Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C7H5ClO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,10H | | InChIKey | DOHOPUBZLWVZMZ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=CC(Cl)=C1O | | CAS DataBase Reference | 1927-94-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2913000090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-CHLORO-2-HYDROXY-BENZALDEHYDE Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 3-Chlorosalicylaldehyde (cas# 1927-94-2) is a compound useful in organic synthesis. | | Synthesis | To a stirred solution of 2-chlorophenol (20.0 g, 155.60 mmol) in acetonitrile (200 mL) at room temperature was added MgCl 2 (22.2 g, 233.35 mmol) and triethylamine (59.03 g, 583.39 mmol). Paraformaldehyde, 0.52 g, 1.05 mol) was added to the mixture and then refluxed for 4 hours. The resulting mixture was cooled to room temperature, quenched with 2N HCl, extracted with ether, dried over MgSO4, filtered and concentrated under reduced pressure. The crude compound was purified by silica gel column chromatography to afford the title compound 3-chloro-2-hydroxybenzene. |
| | 3-CHLORO-2-HYDROXY-BENZALDEHYDE Preparation Products And Raw materials |
|