5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester manufacturers
|
| | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester Basic information |
| Product Name: | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester | | Synonyms: | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester;Benzo[b]thiophene-2-carboxylic acid, 5-methyl-, ethyl ester;Ethyl 5-methylbenzo[b]thiophene-2-carboxylate;ethyl 5-methyl-1-benzothiophene-2-carboxylate;ethyl 5-methylbenzothiophene-2-carboxylate;ethyl 5-methylbenzothiophene-2-carboxylate - [E81102];5-methylbenzenebenzo[b]thiophene-2-carboxylic acidethyl ester | | CAS: | 101219-39-0 | | MF: | C12H12O2S | | MW: | 220.29 | | EINECS: | | | Product Categories: | | | Mol File: | 101219-39-0.mol | ![5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester Structure](CAS/20200119/GIF/101219-39-0.gif) |
| | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester Chemical Properties |
| InChI | InChI=1S/C12H12O2S/c1-3-14-12(13)11-7-9-6-8(2)4-5-10(9)15-11/h4-7H,3H2,1-2H3 | | InChIKey | AUWZTDQPZCZCCJ-UHFFFAOYSA-N | | SMILES | C12=CC=C(C)C=C1C=C(C(OCC)=O)S2 |
| | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester Usage And Synthesis |
| | 5-Methyl-benzo[b]thiophene-2-carboxylic acid ethyl ester Preparation Products And Raw materials |
|