| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | JR-8030, 5-(4-Chlorophenyl)thiophene-2-carbohydrazide, 97% Basic information |
| | JR-8030, 5-(4-Chlorophenyl)thiophene-2-carbohydrazide, 97% Chemical Properties |
| density | 1.375±0.06 g/cm3(Predicted) | | form | solid | | pka | 12.20±0.10(Predicted) | | InChI | 1S/C11H9ClN2OS/c12-8-3-1-7(2-4-8)9-5-6-10(16-9)11(15)14-13/h1-6H,13H2,(H,14,15) | | InChIKey | USXDZLUNNADDNX-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C(S2)=CC=C2C(NN)=O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | JR-8030, 5-(4-Chlorophenyl)thiophene-2-carbohydrazide, 97% Usage And Synthesis |
| | JR-8030, 5-(4-Chlorophenyl)thiophene-2-carbohydrazide, 97% Preparation Products And Raw materials |
|