- 1,1-Diphenylacetone
-
- $0.10 / 1KG
-
2025-12-24
- CAS:781-35-1
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000Tons
- 1,1-Diphenylacetone
-
- $15.00 / 1KG
-
2021-07-02
- CAS:781-35-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,1-Diphenylacetone Basic information |
| Product Name: | 1,1-Diphenylacetone | | Synonyms: | BENZHYDRYL METHYL KETONE;2-OXO-1,1-DIPHENYLPROPANE;1,1-DIPHENYLACETONE;1,1-DIPHENYLPROPAN-2-ONE;1,1-DIPHENYL-2-PROPANONE;UNSYM-DIPHENYLACETONE;1,1-diphenyl-2-propanon;methyldiphenylmethylketone | | CAS: | 781-35-1 | | MF: | C15H14O | | MW: | 210.27 | | EINECS: | 212-307-9 | | Product Categories: | Aromatic Ketones (substituted) | | Mol File: | 781-35-1.mol |  |
| | 1,1-Diphenylacetone Chemical Properties |
| Melting point | 59-63 °C (lit.) | | Boiling point | 135 °C (1.5 mmHg) | | density | 1.0232 (rough estimate) | | refractive index | 1.5361 (estimate) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | BRN | 1910206 | | Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. | | InChI | InChI=1S/C15H14O/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15H,1H3 | | InChIKey | DBNWBEGCONIRGQ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(C1=CC=CC=C1)C(=O)C | | CAS DataBase Reference | 781-35-1(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propanone, 1,1-diphenyl- (781-35-1) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | UC2010020 | | TSCA | TSCA listed | | HS Code | 29143990 | | Storage Class | 11 - Combustible Solids |
| | 1,1-Diphenylacetone Usage And Synthesis |
| Chemical Properties | white to light yellow powder |
| | 1,1-Diphenylacetone Preparation Products And Raw materials |
|