|
|
| | 2-Bromo-6-(trifluoromethyl)pyridine Basic information |
| | 2-Bromo-6-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | 48-52 °C | | Boiling point | 78-79°C 14mm | | density | 1.707±0.06 g/cm3(Predicted) | | Fp | 78-79°C/14mm | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | pka | -3.89±0.12(Predicted) | | form | powder to lump | | color | White to Orange to Green | | InChI | InChI=1S/C6H3BrF3N/c7-5-3-1-2-4(11-5)6(8,9)10/h1-3H | | InChIKey | DOWNSQADAFSSAR-UHFFFAOYSA-N | | SMILES | C1(Br)=NC(C(F)(F)F)=CC=C1 | | CAS DataBase Reference | 189278-27-1(CAS DataBase Reference) |
| Hazard Codes | T,Xi,Xn | | Risk Statements | 25-36/37/38-20/21/22 | | Safety Statements | 26-37/39-45-36/37/39-22 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-6-(trifluoromethyl)pyridine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-Bromo-6-(trifluoromethyl)pyridine is a pyridine compound, which is widely used in medicine, pesticides, dyes, rubber and other fields. |
| | 2-Bromo-6-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|