|
|
| | 3-(2-Fluorophenyl)-3-oxopropionitrile Basic information |
| | 3-(2-Fluorophenyl)-3-oxopropionitrile Chemical Properties |
| Melting point | 60-62 | | Boiling point | 297.3±20.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | solubility | Acetone, Chloroform, Dichloromethane, Ethanol, Ethyl Acetate, Methanol | | form | Solid | | pka | 6.11±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C9H6FNO/c10-8-4-2-1-3-7(8)9(12)5-6-11/h1-4H,5H2 | | InChIKey | WNDLOBWBYQHDQY-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1F)C(=O)CC#N |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2926907090 |
| | 3-(2-Fluorophenyl)-3-oxopropionitrile Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | 2-Fluorobenzoylacetonitrile (cas# 31915-26-1) is a compound useful in organic synthesis. |
| | 3-(2-Fluorophenyl)-3-oxopropionitrile Preparation Products And Raw materials |
|