| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
R(-)-NIGULDIPINE HCL manufacturers
|
| | R(-)-NIGULDIPINE HCL Basic information |
| Product Name: | R(-)-NIGULDIPINE HCL | | Synonyms: | R(-)-NIGULDIPINE HCL;R(-)-NIGULDIPINE HYDROCHLORIDE (B859-35);(R)-1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylicacid3-(4,4-diphenyl-1-piperidinyl)propylmethy;(R)-1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylicacid,3-(4,4-diphenyl-1-piperidinyl)propylmethylesterhydrochloride;R-(?)-Niguldipine hydrochloride | | CAS: | 113145-70-3 | | MF: | C36H40ClN3O6 | | MW: | 646.18 | | EINECS: | | | Product Categories: | | | Mol File: | 113145-70-3.mol |  |
| | R(-)-NIGULDIPINE HCL Chemical Properties |
| storage temp. | −20°C | | solubility | methanol: soluble | | color | pale yellow | | Optical Rotation | [α]23/D 12.5°, c = 0.14 in methanol(lit.) | | InChIKey | MHOSUIMBPQVOEU-MGDILKBHSA-N | | SMILES | Cl.COC(=O)C1=C(C)NC(C)=C([C@@H]1c2cccc(c2)[N+]([O-])=O)C(=O)OCCCN3CCC(CC3)(c4ccccc4)c5ccccc5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | R(-)-NIGULDIPINE HCL Usage And Synthesis |
| Uses | (R)-(-)-Niguldipine Hydrochloride is a potent chemosensitizer in multidrug resistant cells. | | Biological Activity | L-type Ca 2+ channel blocker and α 1A -adrenoceptor antagonist; less active enantiomer. | | Biochem/physiol Actions | Less active enantiomer |
| | R(-)-NIGULDIPINE HCL Preparation Products And Raw materials |
|