| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 1 4 4A 8a-Tetrahydro-endo-1 4-methano- Basic information |
| Product Name: | 1 4 4A 8a-Tetrahydro-endo-1 4-methano- | | Synonyms: | 1,4,4A,8A-tetrahydro-endo-1,4-methano-naphthalene;RHENIUM(IV) OXIDE, 99.7%;Nsc196244;1,4-Methanonaphthalene-5,8-dione, 1,4,4a,8a-tetrahydro-, (1R,4S,4aR,8aS)-rel-;1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione 98%;1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione;1 4 4A 8a-Tetrahydro-endo-1 4-methano- | | CAS: | 51175-59-8 | | MF: | C11H10O2 | | MW: | 174.2 | | EINECS: | | | Product Categories: | Building Blocks;C11 to C12;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;C11 to C12;Carbonyl Compounds;Ketones | | Mol File: | 51175-59-8.mol |  |
| | 1 4 4A 8a-Tetrahydro-endo-1 4-methano- Chemical Properties |
| Melting point | 77-79 °C (lit.) | | Boiling point | 317.6±42.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | form | solid | | pka | 5.8(Solvent: Water; Acetone; Isopropanol) | | InChI | 1S/C11H10O2/c12-8-3-4-9(13)11-7-2-1-6(5-7)10(8)11/h1-4,6-7,10-11H,5H2/t6-,7+,10+,11- | | InChIKey | FQLRTGXTYFCECH-FIPCFZRWSA-N | | SMILES | O=C1C=CC(=O)[C@H]2[C@@H]3C[C@@H](C=C3)[C@@H]12 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1 4 4A 8a-Tetrahydro-endo-1 4-methano- Usage And Synthesis |
| Uses | 1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione may be used in the synthesis of pentacyclo[5.4.0.02,6.03,10.05,9]undecane-8,11-dione (the ′cage′ compound) via the intramolecular [2+2]-photocycloaddition reaction. | | General Description | 1,4,4a,8a-Tetrahydro-endo-1,4-methanonaphthalene-5,8-dione can be prepared by Diels-Alder reaction of cyclopentadiene and 1,4-benzoquinone. |
| | 1 4 4A 8a-Tetrahydro-endo-1 4-methano- Preparation Products And Raw materials |
|