| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Aluminum 1 8 15 22-tetrakis(phenylthio)& Basic information |
| Product Name: | Aluminum 1 8 15 22-tetrakis(phenylthio)& | | Synonyms: | Aluminum 1,8,15,220-tetrakis(phenylthio)-29H,31H-phthalocyanine chloride;Aluminum 1,8,15,22-tetrakis(phenylthio)-29H,31H-phthalocyanine chloride Dye content 90 %;Dye content 90 ;Aluminum 1,8,15,22-tetrakis(phenylthio)-29H,31H-phthalocyanine chloride;Aluminum 1 8 15 22-tetrakis(phenylthio)& | | CAS: | 167093-23-4 | | MF: | C56H32AlN8S4.Cl | | MW: | 1007.62 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 167093-23-4.mol |  |
| | Aluminum 1 8 15 22-tetrakis(phenylthio)& Chemical Properties |
| Melting point | >300 °C(lit.) | | form | powder | | λmax | 759 nm | | InChIKey | WZNPSCVVOXFVGQ-UHFFFAOYSA-M | | SMILES | [Cl-].[Al+]1n2c3nc4nc(nc5n1c(nc6nc(nc2c7c(Sc8ccccc8)cccc37)c9cccc(Sc%10ccccc%10)c69)c%11cccc(Sc%12ccccc%12)c5%11)c%13cccc(Sc%14ccccc%14)c4%13 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Aluminum 1 8 15 22-tetrakis(phenylthio)& Usage And Synthesis |
| | Aluminum 1 8 15 22-tetrakis(phenylthio)& Preparation Products And Raw materials |
|