- Demoxepam
-
-
2026-08-06
- CAS:963-39-3
- Purity: 0.99
|
| | Demoxepam Basic information |
| | Demoxepam Chemical Properties |
| Melting point | 235-236 °C (decomp) | | density | 1.40±0.1 g/cm3(Predicted) | | Fp | 2℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | pKa 4.5 (Uncertain) | | color | White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H11ClN2O2/c16-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)18(20)9-14(19)17-13/h1-8,20H,9H2 | | InChIKey | PSADRZMLSXCSAS-UHFFFAOYSA-N | | SMILES | ClC1=CC2=C(N(CC(=O)N=C2C=C1)O)c3ccccc3 | | NIST Chemistry Reference | Demoxepam(963-39-3) |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-26-36/37 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 3 | | HS Code | 2933996100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Demoxepam Usage And Synthesis |
| Chemical Properties | Crystallizes (dichloromethane/hexane). Melting point 239-241°C. | | Uses | A major metabolite of Chlordiazepoxide (C327050). A benzodiapine derivative with anticonvulsant properties. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 4, p. 647, 1967 DOI: 10.1002/jhet.5570040435
The Journal of Organic Chemistry, 26, p. 4936, 1961 |
| | Demoxepam Preparation Products And Raw materials |
|