| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
(+)-MUSCARINE CHLORIDE manufacturers
|
| | (+)-MUSCARINE CHLORIDE Basic information |
| Product Name: | (+)-MUSCARINE CHLORIDE | | Synonyms: | 4beta,5alpha))-(2alph;l-(+)-muscarinechloride;tetrahydro-4-hydroxy-n,n,n,5-tetramethyl-,chloride,(2s-2-furanmethanaminiu;[2S-(2alpha,4beta,5alpha)]-[tetrahydro-4-hydroxy-5-tetramethylfurfuryl]trimethylammonium chloride;(+)-(2s,4r,5s)-tetrahydro-4-hydroxy-n,n,n,5-tetramethyl-2-furanmethanammonium chloride;(+)-Tetrahydro-4β-hydroxy-N,N,N,5α-tetramethyl-2α-furanmethanaminium chloride, (+)-(2S,4R,5S)-Tetrahydro-4-hydroxy-N,N,N,5-tetramethyl-2-furanmethanammonium chloride;[(2S,4R,5S)-4-hydroxy-5-methyl-oxolan-2-yl]methyl-trimethyl-azanium chloride;[(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium chloride | | CAS: | 2303-35-7 | | MF: | C9H20NO2.Cl | | MW: | 209.71 | | EINECS: | 2189632 | | Product Categories: | | | Mol File: | 2303-35-7.mol |  |
| | (+)-MUSCARINE CHLORIDE Chemical Properties |
| Melting point | 180-181 °C | | solubility | H2O: 50 mg/mL | | form | powder | | color | white | | Water Solubility | H2O: 50mg/mL | | Stability: | Hygroscopic | | InChI | 1S/C9H20NO2.ClH/c1-7-9(11)5-8(12-7)6-10(2,3)4;/h7-9,11H,5-6H2,1-4H3;1H/q+1;/p-1/t7-,8-,9+;/m0./s1 | | InChIKey | WUFRNEJYZWHXLC-CTERPIQNSA-M | | SMILES | [Cl-].C[C@@H]1O[C@@H](C[C@H]1O)C[N+](C)(C)C |
| Hazard Codes | T+ | | Risk Statements | 26/27/28 | | Safety Statements | 28-36/37-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | QG3500000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Inhalation
Acute Tox. 2 Dermal
Acute Tox. 2 Oral | | Hazardous Substances Data | 2303-35-7(Hazardous Substances Data) |
| | (+)-MUSCARINE CHLORIDE Usage And Synthesis |
| Uses | (+)-Muscarine Chloride modulates calcium channel currents in rats. | | Biological Activity | Prototype muscarinic acetylcholine receptor agonist; active enantiomer. |
| | (+)-MUSCARINE CHLORIDE Preparation Products And Raw materials |
|