| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Scandium(III) hexafluoroacetylacetonate Basic information |
| Product Name: | Scandium(III) hexafluoroacetylacetonate | | Synonyms: | Scandium, tris(1,1,1,5,5,5-hexafluoro-2,4-pentanedionato-O,O'-);Scandium,tris(1,1,1,5,5,5-hexafluoro-2,4-pentanedionato-O,O')-,(OC-6-11)-;Scandium(lll) hexafluoroacetylacetonate;Scandium hexafluoracetylacetonate;(E)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one:scandium;Scandium tris[(2Z)-1,1,1,5,5,5-hexafluoro-4-oxo-2-penten-2-olate;Scandium hexafluoroacetylacetonate( Sc(thd)3);Scandium(III) hexafluoroacetylacetonate | | CAS: | 18990-42-6 | | MF: | C15H3F18O6Sc | | MW: | 666.11 | | EINECS: | | | Product Categories: | Catalysis and Inorganic Chemistry;Chemical Synthesis;Scandium;ScandiumMicro/Nanoelectronics;Solution Deposition Precursors | | Mol File: | 18990-42-6.mol |  |
| | Scandium(III) hexafluoroacetylacetonate Chemical Properties |
| Melting point | 93-96 °C | | Boiling point | 93-96 °C(lit.) | | form | powder (may contain chunks) | | InChI | 1S/3C5H2F6O2.Sc/c3*6-4(7,8)2(12)1-3(13)5(9,10)11;/h3*1,12H;/q;;;+3/p-3/b3*2-1-; | | InChIKey | DWCYUTXXZMNFLG-JVUUZWNBSA-K | | SMILES | FC(F)(F)C(=O)\C=C(/O[Sc](O\C(=C/C(=O)C(F)(F)F)C(F)(F)F)O\C(=C/C(=O)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Scandium(III) hexafluoroacetylacetonate Usage And Synthesis |
| reaction suitability | core: scandium
reagent type: catalyst |
| | Scandium(III) hexafluoroacetylacetonate Preparation Products And Raw materials |
|