| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | Sodium Dichloroacetate-13C2 Basic information |
| | Sodium Dichloroacetate-13C2 Chemical Properties |
| Melting point | 198°C (dec.) | | form | powder | | InChI | 1S/C2H2Cl2O2.Na/c3-1(4)2(5)6;/h1H,(H,5,6);/q;+1/p-1/i1+1,2+1; | | InChIKey | LUPNKHXLFSSUGS-AWQJXPNKSA-M | | SMILES | [Na+].[O-][13C](=O)[13CH](Cl)Cl |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Sodium Dichloroacetate-13C2 Usage And Synthesis |
| Uses | Sodium dichloroacetate-13C2 is a labelled analogue of sodium dichloroacetate. Sodium dichloroacetate is a potential antidote for lactic acidosis and also has potential for treating patients with stroke. Since sodium dichloroacetate also might have mutagenic properties, it is still currently under investigation to determine whether or not its use is safe in humans. |
| | Sodium Dichloroacetate-13C2 Preparation Products And Raw materials |
|