| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester Basic information |
| Product Name: | cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester | | Synonyms: | (Z)-1,2-Diphenyl-1,2-ethylenediboronic acid bis(pinacol) ester, 96%;(Z)-Stilbenediboronic acid bis(pinacol) ester, 98%;1,3,2-Dioxaborolane, 2,2'-(1,2-diphenyl-1,2-ethenediyl)bis[4,4,5,5-tetramethyl-;2-[1,2-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-[1,2-diphenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)vinyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;(Z)-1,2-Diphenyl-1,2-ethylenediboronic acid bis(pinacol) ester;cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester | | CAS: | 221006-76-4 | | MF: | C26H34B2O4 | | MW: | 432.17 | | EINECS: | | | Product Categories: | | | Mol File: | 221006-76-4.mol |  |
| | cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester Chemical Properties |
| Melting point | 176-179°C | | BRN | 9081275 | | InChI | 1S/C26H34B2O4/c1-23(2)24(3,4)30-27(29-23)21(19-15-11-9-12-16-19)22(20-17-13-10-14-18-20)28-31-25(5,6)26(7,8)32-28/h9-18H,1-8H3/b22-21- | | InChIKey | YFLBNMYBKXYNJN-DQRAZIAOSA-N | | SMILES | CC1(C)OB(OC1(C)C)C(\c2ccccc2)=C(/B3OC(C)(C)C(C)(C)O3)c4ccccc4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester Usage And Synthesis |
| | cis-1,2-Diborono-1,2-diphenylethylene, dipinacol ester Preparation Products And Raw materials |
|