| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | D-[13C5]Xylose Basic information |
| | D-[13C5]Xylose Chemical Properties |
| Melting point | 140-145oC | | density | 1.508±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Refrigerator | | solubility | Methanol (Slightly, Heated), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +15°, c =1 in H2O | | InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3+,4-,5/m1/s1/i1+1,2+1,3+1,4+1,5+1 | | InChIKey | SRBFZHDQGSBBOR-DEQZYICDSA-N | | SMILES | O[13C@@H]1[13CH2]O[13CH](O)[13C@H](O)[13C@H]1O | | CAS Number Unlabeled | 58-86-6 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | D-[13C5]Xylose Usage And Synthesis |
| Uses | D-[13C5]Xylose is a labeled analog of D-Xylose, which is used in diagnostic malabsorption tests as well as in the production of Furfural. |
| | D-[13C5]Xylose Preparation Products And Raw materials |
|