|
|
| | 229614-17-9 Basic information |
| Product Name: | 229614-17-9 | | Synonyms: | methyl (1S,2S,3R,4R)-3-((S)-1-acetamido-2-ethylbutyl)-4-amino-2- hydroxycyclopentane-1-carboxylate hydrochloride;Peramivir impurities435;Peramivir impurities1;Paramivir impurity 23;Peramivir Impurity 49 HCl;Peramivir Impurity 13/(1S,2S,3R,4R)-Methyl 3-((S)-1-acetamido-2-ethylbutyl)-4-amino-2-hydroxycyclopentane-1-carboxylate hydrochloride;Peramivir Impurity 11 HCl | | CAS: | 229614-17-9 | | MF: | C15H29ClN2O4 | | MW: | 336.86 | | EINECS: | | | Product Categories: | | | Mol File: | 229614-17-9.mol |  |
| | 229614-17-9 Chemical Properties |
| InChI | InChI=1/C15H28N2O4.ClH/c1-5-9(6-2)13(17-8(3)18)12-11(16)7-10(14(12)19)15(20)21-4;/h9-14,19H,5-7,16H2,1-4H3,(H,17,18);1H/t10-,11+,12+,13-,14+;/s3 | | InChIKey | IQZPAZHCBKIMDN-YYANSXTKNA-N | | SMILES | [C@H]([C@@]1([H])[C@@H](C[C@H](C(=O)OC)[C@H]1O)N)(NC(=O)C)C(CC)CC.Cl |&1:0,1,3,5,10,r| |
| | 229614-17-9 Usage And Synthesis |
| | 229614-17-9 Preparation Products And Raw materials |
|