| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(2-hydroxybenzyl)diphenylphosphine oxide manufacturers
|
| | (2-hydroxybenzyl)diphenylphosphine oxide Basic information |
| Product Name: | (2-hydroxybenzyl)diphenylphosphine oxide | | Synonyms: | (2-hydroxybenzyl)diphenylphosphine oxide;diphenyl(2-hydroxyphenylmethyl)phosphine oxide;2-(Diphenylphosphinylmethyl)phenol;Phenol, 2-[(diphenylphosphinyl)methyl]-;2-[(Diphenylphosphinoyl)methyl]phenol;2-[(Diphenylphosphoroso)methyl]phenol;2-[(Diphenylphosphoryl)methyl]phenol | | CAS: | 70127-50-3 | | MF: | C19H17O2P | | MW: | 308.31 | | EINECS: | | | Product Categories: | | | Mol File: | 70127-50-3.mol |  |
| | (2-hydroxybenzyl)diphenylphosphine oxide Chemical Properties |
| Melting point | 156 °C (polymorph) | | Boiling point | 465.1±28.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.49±0.35(Predicted) | | color | Off-White | | InChI | InChI=1S/C19H17O2P/c20-19-14-8-7-9-16(19)15-22(21,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14,20H,15H2 | | InChIKey | NQWHOPCJTGVYOX-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC=C1CP(C1=CC=CC=C1)(C1=CC=CC=C1)=O |
| | (2-hydroxybenzyl)diphenylphosphine oxide Usage And Synthesis |
| Uses | 1. Reagent used in redox neutral organocatalytic Mitsunobu reactions. |
| | (2-hydroxybenzyl)diphenylphosphine oxide Preparation Products And Raw materials |
|