1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester manufacturers
- NOTA-(COOt-Bu)2
-
-
2025-06-07
- CAS:1161415-28-6
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester Basic information |
| Product Name: | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester | | Synonyms: | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester;2-{4,7-BIS-TERT-BUTOXYCARBONYLMETHYL-[1,4,7] TRIAZOCYCLONONAN-1-YL}ACETIC ACID;2-S(4-Isothiocyanatobenzyl)-1, 4, 7-triazacyclononane-1, 4, 7-triacetic acid;NOTA-bis(t-Butyl ester);bis-t-butyl-NOTA;2-[4,7-Bis[2-(tert-butoxy)-2-oxoethyl]-1,4,7-triazonan-1-yl]acetic Acid;NOTA-(COOt-Bu)2;NOTA-bis(t-Bu ester),1,4,7-Triazacyclononane-1,4-bis-tert-butyl acetate-7-acetic acid | | CAS: | 1161415-28-6 | | MF: | C20H37N3O6 | | MW: | 415.52 | | EINECS: | | | Product Categories: | PDC Linker | | Mol File: | 1161415-28-6.mol |  |
| | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester Chemical Properties |
| Boiling point | 519.9±50.0 °C(Predicted) | | density | 1.095±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | 4.37±0.10(Predicted) | | form | Solid | | color | Pale Yellow to Yellow | | Stability: | Hygroscopic | | InChI | InChI=1S/C20H37N3O6/c1-19(2,3)28-17(26)14-22-9-7-21(13-16(24)25)8-10-23(12-11-22)15-18(27)29-20(4,5)6/h7-15H2,1-6H3,(H,24,25) | | InChIKey | UACSRZWSADEYPK-UHFFFAOYSA-N | | SMILES | C(N1CCN(CCN(CC1)CC(=O)OC(C)(C)C)CC(=O)O)C(=O)OC(C)(C)C |
| | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester Usage And Synthesis |
| Description | 2-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)acetic acid is a bifunctional chelating agent with two t-butyl groups and one acid group that shows high complexation constant with metals. | | Uses | NOTA-bis(t-Bu ester), is a bifunctional chelator. | | IC 50 | RDC Bifunctional Chelator |
| | 1H-1,4,7-Triazonine-1,4,7-triacetic acid, hexahydro-, 1,4-bis(1,1-dimethylethyl) ester Preparation Products And Raw materials |
|