2-Bromo-7-chlorodibenzo[b,d]furan manufacturers
|
| | 2-Bromo-7-chlorodibenzo[b,d]furan Basic information |
| | 2-Bromo-7-chlorodibenzo[b,d]furan Chemical Properties |
| Boiling point | 376.4±22.0 °C(Predicted) | | density | 1.669±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H6BrClO/c13-7-1-4-11-10(5-7)9-3-2-8(14)6-12(9)15-11/h1-6H | | InChIKey | QCGWGYFVRUSBRM-UHFFFAOYSA-N | | SMILES | O1C2=CC(Cl)=CC=C2C2=CC(Br)=CC=C12 |
| | 2-Bromo-7-chlorodibenzo[b,d]furan Usage And Synthesis |
| Uses | 2-Bromo-7-chlorodibenzo[b,d]furan is used as an organic synthesis reagent or pharmaceutical intermediate. |
| | 2-Bromo-7-chlorodibenzo[b,d]furan Preparation Products And Raw materials |
|