Phosphinous amide, N-(diphenylphosphino)-N-(1-methylethyl)-P,P-diphenyl- manufacturers
|
| | Phosphinous amide, N-(diphenylphosphino)-N-(1-methylethyl)-P,P-diphenyl- Basic information |
| | Phosphinous amide, N-(diphenylphosphino)-N-(1-methylethyl)-P,P-diphenyl- Chemical Properties |
| Boiling point | 536.4±33.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | 0.73±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C27H27NP2/c1-23(2)28(29(24-15-7-3-8-16-24)25-17-9-4-10-18-25)30(26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23H,1-2H3 | | InChIKey | CJYMDPCRSWLYSQ-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)N(P(C1=CC=CC=C1)C1=CC=CC=C1)C(C)C |
| | Phosphinous amide, N-(diphenylphosphino)-N-(1-methylethyl)-P,P-diphenyl- Usage And Synthesis |
| | Phosphinous amide, N-(diphenylphosphino)-N-(1-methylethyl)-P,P-diphenyl- Preparation Products And Raw materials |
|