4-Dodecyloxy-m-phenylenediamine manufacturers
|
| | 4-Dodecyloxy-m-phenylenediamine Basic information | | Application |
| Product Name: | 4-Dodecyloxy-m-phenylenediamine | | Synonyms: | 4-Dodecyloxy-m-phenylenediamine;1,3-Benzenediamine, 4-(dodecyloxy)-;4-Dodecyloxy-m-phenylenediamine ISO 9001：2015 REACH;ET-12/4-Dodecyloxy-m-phenylenediamine;1-dodecanoxy-2, 4-phenylenediamine;12PDA | | CAS: | 141505-05-7 | | MF: | C18H32N2O | | MW: | 292.46 | | EINECS: | | | Product Categories: | PI | | Mol File: | 141505-05-7.mol |  |
| | 4-Dodecyloxy-m-phenylenediamine Chemical Properties |
| Boiling point | 443.5±25.0 °C(Predicted) | | density | 0.976±0.06 g/cm3(Predicted) | | pka | 5.21±0.10(Predicted) | | InChI | InChI=1S/C18H32N2O/c1-2-3-4-5-6-7-8-9-10-11-14-21-18-13-12-16(19)15-17(18)20/h12-13,15H,2-11,14,19-20H2,1H3 | | InChIKey | YBNWBQXABYLBMR-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(OCCCCCCCCCCCC)C(N)=C1 |
| | 4-Dodecyloxy-m-phenylenediamine Usage And Synthesis |
| Application | 1-Dodecyloxy-2,4-phenylenediamine can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production synthesis processes. |
| | 4-Dodecyloxy-m-phenylenediamine Preparation Products And Raw materials |
|