|
|
| | JWG-071 Basic information |
| Product Name: | JWG-071 | | Synonyms: | JWG-071;6H-Pyrimido[4,5-b][1,4]benzodiazepin-6-one, 5,11-dihydro-2-[[2-methoxy-4-[[4-(4-methyl-1-piperazinyl)-1-piperidinyl]carbonyl]phenyl]amino]-5-methyl-11-(1-methylpropyl)-;JWG 071,JWG071;11-(sec-Butyl)-2-((2-methoxy-4-(4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl)phenyl)amino)-5-methyl-5,11-dihydro-6H-benzo[e]pyrimido[5,4-b][1,4]diazepin-6-one;JWG-071, 10 mM in DMSO;2-(Butan-2-yl)-5-({2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidine-1-carbonyl]phenyl}amino)-9-methyl-2,4,6,9-tetraazatricyclo[9.4. 0.03,?]pentadeca-1(15),3,5,7,11,13-hexaen-10-one | | CAS: | 2250323-50-1 | | MF: | C34H44N8O3 | | MW: | 612.77 | | EINECS: | | | Product Categories: | | | Mol File: | 2250323-50-1.mol |  |
| | JWG-071 Chemical Properties |
| Boiling point | 801.7±75.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 8.14±0.42(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChIKey | ACWOMSOYIIVIRV-UHFFFAOYSA-N | | SMILES | N1(C(C)CC)C2=CC=CC=C2C(=O)N(C)C2=CN=C(NC3=CC=C(C(N4CCC(N5CCN(C)CC5)CC4)=O)C=C3OC)N=C12 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | JWG-071 Usage And Synthesis |
| Uses | JWG-071 is the kinase-selective chemical probe for ERK5. JWG-071 inhibits ERK5 and LRRK2 with IC50 values of 88nM and 109 nM, respectively[1]. | | Biological Activity | JWG-071 is the first reported ERK5 kinase-selective chemical probe which can increases ERK5 activity and BRD4 selectivity. It will be a much-needed chemical probe for deconvoluted ERK5 and BRD4 pharmacology. | | in vitro | JWG-071 inhibits ERK5 and LRRK2 with IC 50 of 88 and 109 nM, respectively. < /div> | | target | | | IC 50 | ERK5: 88 nM (IC50) | | References | [1] Wang J, et al. Structural and Atropisomeric Factors Governing the Selectivity of Pyrimido-benzodiazipinonesas Inhibitors of Kinases and Bromodomains. ACS Chem Biol. 2018 Sep 21;13(9):2438-2448 DOI:10.1021/acschembio.7b00638 |
| | JWG-071 Preparation Products And Raw materials |
|