- 3,4-DIMETHYL PYRAZOLE
-
- $10.00 / 1KG
-
2026-01-05
- CAS:2820-37-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 3,4-DIMETHYL PYRAZOLE
-
- $50.00 / 25KG
-
2019-07-06
- CAS:2820-37-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 40T
|
| | 3,4-DIMETHYL PYRAZOLE Basic information |
| Product Name: | 3,4-DIMETHYL PYRAZOLE | | Synonyms: | 3,4-Dimethyl-1H-pyrazol;3,4-DIMETHYL PYRAZOLE;4,5-dimethyl-1H-pyrazole;3,4-Dimethyl-1;1H-Pyrazole, 3,4-dimethyl-;3,4-Dimethyl-1H-pyrazole;4,5-dimethyl-lH pyrazole;3,4-DIMETHYL PYRAZOLE 、 DMP | | CAS: | 2820-37-3 | | MF: | C5H8N2 | | MW: | 96.13 | | EINECS: | 429-130-1 | | Product Categories: | Heterocyclic Compounds;Bases & Related Reagents;Heterocycles;Nucleotides | | Mol File: | 2820-37-3.mol |  |
| | 3,4-DIMETHYL PYRAZOLE Chemical Properties |
| Melting point | 44-46°C | | Boiling point | 189.67°C (rough estimate) | | density | 0.9325 | | refractive index | 1.4739 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetonitrile (Very Slightly), Chloroform (Slightly) | | pka | 15.51±0.50(Predicted) | | form | Fused Solid | | color | Cream | | Water Solubility | Slightly soluble in water. | | BRN | 1621 | | InChI | InChI=1S/C5H8N2/c1-4-3-6-7-5(4)2/h3H,1-2H3,(H,6,7) | | InChIKey | VQTVFIMEENGCJA-UHFFFAOYSA-N | | SMILES | N1C=C(C)C(C)=N1 | | EPA Substance Registry System | 1H-Pyrazole, 3,4-dimethyl- (2820-37-3) |
| Hazard Codes | Xn | | Risk Statements | 22-41-52/53 | | Safety Statements | 26-39-61 | | WGK Germany | 3 | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 |
| | 3,4-DIMETHYL PYRAZOLE Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | 3,4-Dimethyl-1H-pyrazole is used as pharmaceutical intermediate. | | Definition | ChEBI: 3,4-dimethyl-1H-pyrazole is a member of the class of pyrazoles that is 1H-pyrazole which is substituted by methyl groups at positions 3 and 4. |
| | 3,4-DIMETHYL PYRAZOLE Preparation Products And Raw materials |
|