Boc-L-Tyr(Et)-oL manufacturers
- Boc-L-Tyr(Et)-oL
-
-
2026-07-03
- CAS:1252686-29-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kgs
|
| | Boc-L-Tyr(Et)-oL Basic information |
| Product Name: | Boc-L-Tyr(Et)-oL | | Synonyms: | Boc-L-Tyr(Et)-oL;Carbamic acid, N-[(1S)-2-(4-ethoxyphenyl)-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester;Gadoxetate Disodium Impurity 2;(S)-tert-Butyl (1-(4-ethoxyphenyl)-3-hydroxypropan-2-yl)carbamate;(S)-(1-(4-Ethoxyphenyl)-3-hydroxypropan-2-yl)carbamicacidtert-butylester;N-tert-butoxy-[(S)-1-(4-ethoxyphenmethyl)-2-hydroxyethyl]carboxamide;(S)-tert-Butyl (1-(4-ethoxyphenyl)-3-hydroxypropan-2-yl)carbamate - [B92153];(S)-(1-(4-ethoxyphenyl)-3-hydroxypropyl-2-yl)aminomacetic acidtertbutyl ester | | CAS: | 1252686-29-5 | | MF: | C16H25NO4 | | MW: | 295.37 | | EINECS: | | | Product Categories: | | | Mol File: | 1252686-29-5.mol |  |
| | Boc-L-Tyr(Et)-oL Chemical Properties |
| Boiling point | 455.4±40.0 °C(Predicted) | | density | 1.085±0.06 g/cm3(Predicted) | | pka | 11.92±0.46(Predicted) | | InChI | InChI=1S/C16H25NO4/c1-5-20-14-8-6-12(7-9-14)10-13(11-18)17-15(19)21-16(2,3)4/h6-9,13,18H,5,10-11H2,1-4H3,(H,17,19)/t13-/m0/s1 | | InChIKey | PEQJFSCMVOFENB-ZDUSSCGKSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H](CO)CC1=CC=C(OCC)C=C1 |
| | Boc-L-Tyr(Et)-oL Usage And Synthesis |
| | Boc-L-Tyr(Et)-oL Preparation Products And Raw materials |
|