- FLUCONAZOLE IMPURITY C
-
- $7.00 / 1KG
-
2020-01-10
- CAS:514222-44-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | FLUCONAZOLE IMPURITY C Basic information |
| Product Name: | FLUCONAZOLE IMPURITY C | | Synonyms: | FLUCONAZOLE IMPURITY C;1,3-Di(1H-1,2,4-triazol-1-yl)benzene;Fluconazole USP Related Compound C;Fluconazole Impurity 3(Fluconazole EP Impurity C);1,1'-(1,3-Phenylene)bis-1H-1,2,4-triazole;Fluconazole Related Compound C;1,1'-(1,3-phenylene)di-1H-1,2,4-triazole;fluconazole related substance EP C | | CAS: | 514222-44-7 | | MF: | C10H8N6 | | MW: | 212.21 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | Mol File |  |
| | FLUCONAZOLE IMPURITY C Chemical Properties |
| Melting point | >209°C (Slightly) | | Boiling point | 485.7±55.0 °C(Predicted) | | density | 1.42 | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | pka | 2.15±0.11(Predicted) | | color | Pale Yellow to Light Beige | | Stability: | Light Sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C10H8N6/c1-2-9(15-7-11-5-13-15)4-10(3-1)16-8-12-6-14-16/h1-8H | | InChIKey | WXNXRKYXCCDJHI-UHFFFAOYSA-N | | SMILES | C1(N2C=NC=N2)=CC=CC(N2C=NC=N2)=C1 |
| WGK Germany | 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids |
| | FLUCONAZOLE IMPURITY C Usage And Synthesis |
| Uses | Fluconazole (F421000) impurity. | | Uses | 1,1''-(1,3-Phenylene)bis-1H-1,2,4-triazole (Fluconazole EP Impurity C) is a Fluconazole (F421000) impurity. |
| | FLUCONAZOLE IMPURITY C Preparation Products And Raw materials |
|