Pyridoxine Impurity 31 manufacturers
|
| | Pyridoxine Impurity 31 Basic information |
| Product Name: | Pyridoxine Impurity 31 | | Synonyms: | Pyridoxine Impurity 31;Vitamin B6 Impurity 57;Pyridoxine Impurity 16 Ditrifluoroacetate;Vitamin B6 Impurity 14 HCl;1-((3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-4-yl)methyl)-4,5-bis(hydroxymethyl)-2-methylpyridin-1-ium-3-olate | | CAS: | 18436-47-0 | | MF: | C16H20N2O5 | | MW: | 320.35 | | EINECS: | | | Product Categories: | | | Mol File: | 18436-47-0.mol |  |
| | Pyridoxine Impurity 31 Chemical Properties |
| InChI | InChI=1S/C16H20N2O5/c1-9-15(22)13(11(6-19)3-17-9)5-18-4-12(7-20)14(8-21)16(23)10(18)2/h3-4,19-21H,5-8H2,1-2H3,(H-,22,23) | | InChIKey | IUFWHHXTKMEIOU-UHFFFAOYSA-N | | SMILES | C(C1=C(C(C)=NC=C1CO)O)[N+]1=C(C([O-])=C(CO)C(CO)=C1)C |
| | Pyridoxine Impurity 31 Usage And Synthesis |
| | Pyridoxine Impurity 31 Preparation Products And Raw materials |
|